C10H17NO2 — CID 142030506
ethane;4-(methylaminomethyl)benzene-1,2-diol (PubChem CID 142030506) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is ethane;4-(methylaminomethyl)benzene-1,2-diol.
| Compound Name | ethane;4-(methylaminomethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 142030506 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | ethane;4-(methylaminomethyl)benzene-1,2-diol |
| SMILES | CC.CNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2.C2H6/c1-9-5-6-2-3-7(10)8(11)4-6;1-2/h2-4,9-11H,5H2,1H3;1-2H3 |
| InChIKey | NIRVLYMFNLLPBT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|