C15H17NO3 — CID 175403126
3,4-dihydroxybenzaldehyde;N-methyl-1-phenylmethanamine (PubChem CID 175403126) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3,4-dihydroxybenzaldehyde;N-methyl-1-phenylmethanamine.
| Compound Name | 3,4-dihydroxybenzaldehyde;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 175403126 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3,4-dihydroxybenzaldehyde;N-methyl-1-phenylmethanamine |
| SMILES | CNCc1ccccc1.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11N.C7H6O3/c1-9-7-8-5-3-2-4-6-8;8-4-5-1-2-6(9)7(10)3-5/h2-6,9H,7H2,1H3;1-4,9-10H |
| InChIKey | VECHVTRQJZRUEG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|