C10H15NO2 — CID 14515291
4-[3-(methylamino)propyl]benzene-1,2-diol (PubChem CID 14515291) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-[3-(methylamino)propyl]benzene-1,2-diol.
| Compound Name | 4-[3-(methylamino)propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 14515291 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4-[3-(methylamino)propyl]benzene-1,2-diol |
| SMILES | CNCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H15NO2/c1-11-6-2-3-8-4-5-9(12)10(13)7-8/h4-5,7,11-13H,2-3,6H2,1H3 |
| InChIKey | VEPQOBRMGLTOBJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|