C8H12ClNO3 — CID 142760591
4-[2-(chloroamino)ethyl]benzene-1,2-diol;hydrate (PubChem CID 142760591) has the molecular formula C8H12ClNO3 and a molecular weight of 205.64 g/mol. Its IUPAC name is 4-[2-(chloroamino)ethyl]benzene-1,2-diol;hydrate.
| Compound Name | 4-[2-(chloroamino)ethyl]benzene-1,2-diol;hydrate |
|---|---|
| PubChem CID | 142760591 |
| Molecular Formula | C8H12ClNO3 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-[2-(chloroamino)ethyl]benzene-1,2-diol;hydrate |
| SMILES | O.Oc1ccc(CCNCl)cc1O |
| InChI | InChI=1S/C8H10ClNO2.H2O/c9-10-4-3-6-1-2-7(11)8(12)5-6;/h1-2,5,10-12H,3-4H2;1H2 |
| InChIKey | QYHWDYGUJMVMDT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|