C15H17NO4 — CID 3027257
4-[2-[(3,4-dihydroxyphenyl)methylamino]ethyl]benzene-1,2-diol (PubChem CID 3027257) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 4-[2-[(3,4-dihydroxyphenyl)methylamino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[(3,4-dihydroxyphenyl)methylamino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 3027257 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-[2-[(3,4-dihydroxyphenyl)methylamino]ethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCNCc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C15H17NO4/c17-12-3-1-10(7-14(12)19)5-6-16-9-11-2-4-13(18)15(20)8-11/h1-4,7-8,16-20H,5-6,9H2 |
| InChIKey | WHHSKYFOFHBPED-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|