C11H17NO4 — CID 70596996
4-[2-(2,3-dihydroxypropylamino)ethyl]benzene-1,2-diol (PubChem CID 70596996) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-[2-(2,3-dihydroxypropylamino)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-(2,3-dihydroxypropylamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 70596996 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-[2-(2,3-dihydroxypropylamino)ethyl]benzene-1,2-diol |
| SMILES | OCC(O)CNCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H17NO4/c13-7-9(14)6-12-4-3-8-1-2-10(15)11(16)5-8/h1-2,5,9,12-16H,3-4,6-7H2 |
| InChIKey | SKRLDUYAENPCTR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|