C13H21NO2 — CID 115122267
3-[2-(4-ethylphenyl)ethylamino]propane-1,2-diol (PubChem CID 115122267) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-[2-(4-ethylphenyl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[2-(4-ethylphenyl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 115122267 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-[2-(4-ethylphenyl)ethylamino]propane-1,2-diol |
| SMILES | CCc1ccc(CCNCC(O)CO)cc1 |
| InChI | InChI=1S/C13H21NO2/c1-2-11-3-5-12(6-4-11)7-8-14-9-13(16)10-15/h3-6,13-16H,2,7-10H2,1H3 |
| InChIKey | DCDVBVGZDKEVCX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|