C14H21NO2S — CID 115122351
3-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethylamino]propane-1,2-diol (PubChem CID 115122351) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 115122351 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethylamino]propane-1,2-diol |
| SMILES | OCC(O)CNCCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C14H21NO2S/c16-10-13(17)9-15-6-5-11-3-4-14-12(8-11)2-1-7-18-14/h3-4,8,13,15-17H,1-2,5-7,9-10H2 |
| InChIKey | NMMZWYFNWPKKSD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|