C15H22N2S — CID 115207833
N-(azetidin-3-ylmethyl)-2-(3,4-dihydro-2H-thiochromen-6-yl)ethanamine (PubChem CID 115207833) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-2-(3,4-dihydro-2H-thiochromen-6-yl)ethanamine.
| Compound Name | N-(azetidin-3-ylmethyl)-2-(3,4-dihydro-2H-thiochromen-6-yl)ethanamine |
|---|---|
| PubChem CID | 115207833 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-2-(3,4-dihydro-2H-thiochromen-6-yl)ethanamine |
| SMILES | c1cc2c(cc1CCNCC1CNC1)CCCS2 |
| InChI | InChI=1S/C15H22N2S/c1-2-14-8-12(3-4-15(14)18-7-1)5-6-16-9-13-10-17-11-13/h3-4,8,13,16-17H,1-2,5-7,9-11H2 |
| InChIKey | GEBNJMKGCJTSDP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|