C13H16N2O2S — CID 115192143
N'-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]oxamide (PubChem CID 115192143) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]oxamide.
| Compound Name | N'-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 115192143 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]oxamide |
| SMILES | NC(=O)C(=O)NCCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H16N2O2S/c14-12(16)13(17)15-6-5-9-3-4-11-10(8-9)2-1-7-18-11/h3-4,8H,1-2,5-7H2,(H2,14,16)(H,15,17) |
| InChIKey | VPHGRLIFKKCYJE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|