C13H14O2S — CID 116866278
2-(3,4-dihydro-2H-thiochromen-6-ylmethyl)prop-2-enoic acid (PubChem CID 116866278) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-6-ylmethyl)prop-2-enoic acid.
| Compound Name | 2-(3,4-dihydro-2H-thiochromen-6-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 116866278 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiochromen-6-ylmethyl)prop-2-enoic acid |
| SMILES | C=C(Cc1ccc2c(c1)CCCS2)C(=O)O |
| InChI | InChI=1S/C13H14O2S/c1-9(13(14)15)7-10-4-5-12-11(8-10)3-2-6-16-12/h4-5,8H,1-3,6-7H2,(H,14,15) |
| InChIKey | XKRSTRDBHWCBDX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|