C10H11BrS — CID 116932395
6-(bromomethyl)-3,4-dihydro-2H-thiochromene (PubChem CID 116932395) has the molecular formula C10H11BrS and a molecular weight of 243.17 g/mol. Its IUPAC name is 6-(bromomethyl)-3,4-dihydro-2H-thiochromene.
| Compound Name | 6-(bromomethyl)-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 116932395 |
| Molecular Formula | C10H11BrS |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 6-(bromomethyl)-3,4-dihydro-2H-thiochromene |
| SMILES | BrCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C10H11BrS/c11-7-8-3-4-10-9(6-8)2-1-5-12-10/h3-4,6H,1-2,5,7H2 |
| InChIKey | RULWSOFYISVKRH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|