C14H22SSi — CID 150445494
2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-trimethylsilane (PubChem CID 150445494) has the molecular formula C14H22SSi and a molecular weight of 250.48 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-trimethylsilane.
| Compound Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-trimethylsilane |
|---|---|
| PubChem CID | 150445494 |
| Molecular Formula | C14H22SSi |
| Molecular Weight | 250.48 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C14H22SSi/c1-16(2,3)10-8-12-6-7-14-13(11-12)5-4-9-15-14/h6-7,11H,4-5,8-10H2,1-3H3 |
| InChIKey | HMRCYHWDOQOLLX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|