C13H16ClNOS — CID 115195091
N-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]-N-methylcarbamoyl chloride (PubChem CID 115195091) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]-N-methylcarbamoyl chloride.
| Compound Name | N-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 115195091 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl]-N-methylcarbamoyl chloride |
| SMILES | CN(CCc1ccc2c(c1)CCCS2)C(=O)Cl |
| InChI | InChI=1S/C13H16ClNOS/c1-15(13(14)16)7-6-10-4-5-12-11(9-10)3-2-8-17-12/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | RFLUYYVQJKRMMG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|