C13H18N2OS — CID 116847499
2-(3,4-dihydro-2H-thiochromen-6-yl)-N',N'-dimethylacetohydrazide (PubChem CID 116847499) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-6-yl)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 116847499 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)Cc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H18N2OS/c1-15(2)14-13(16)9-10-5-6-12-11(8-10)4-3-7-17-12/h5-6,8H,3-4,7,9H2,1-2H3,(H,14,16) |
| InChIKey | RQOQDGNOWIJAIF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|