C12H17NOS — CID 115229206
[3,4-dihydro-2H-thiochromen-6-ylmethyl(methyl)amino]methanol (PubChem CID 115229206) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is [3,4-dihydro-2H-thiochromen-6-ylmethyl(methyl)amino]methanol.
| Compound Name | [3,4-dihydro-2H-thiochromen-6-ylmethyl(methyl)amino]methanol |
|---|---|
| PubChem CID | 115229206 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | [3,4-dihydro-2H-thiochromen-6-ylmethyl(methyl)amino]methanol |
| SMILES | CN(CO)Cc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H17NOS/c1-13(9-14)8-10-4-5-12-11(7-10)3-2-6-15-12/h4-5,7,14H,2-3,6,8-9H2,1H3 |
| InChIKey | OEBGFESTYVLYLZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|