C11H15NS2 — CID 115227824
[3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]methanethiol (PubChem CID 115227824) has the molecular formula C11H15NS2 and a molecular weight of 225.38 g/mol. Its IUPAC name is [3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]methanethiol.
| Compound Name | [3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]methanethiol |
|---|---|
| PubChem CID | 115227824 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | [3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]methanethiol |
| SMILES | CN(CS)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C11H15NS2/c1-12(8-13)10-4-5-11-9(7-10)3-2-6-14-11/h4-5,7,13H,2-3,6,8H2,1H3 |
| InChIKey | UCDWMHKJFUESKZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|