C12H18N2S — CID 115226735
N'-(3,4-dihydro-2H-thiochromen-6-yl)-N,N'-dimethylmethanediamine (PubChem CID 115226735) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-thiochromen-6-yl)-N,N'-dimethylmethanediamine.
| Compound Name | N'-(3,4-dihydro-2H-thiochromen-6-yl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 115226735 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N'-(3,4-dihydro-2H-thiochromen-6-yl)-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H18N2S/c1-13-9-14(2)11-5-6-12-10(8-11)4-3-7-15-12/h5-6,8,13H,3-4,7,9H2,1-2H3 |
| InChIKey | QVUWYZVTXFPYOV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|