C11H15N3OS — CID 115226717
6-[methyl(methylaminomethyl)amino]-4H-1,4-benzothiazin-3-one (PubChem CID 115226717) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 6-[methyl(methylaminomethyl)amino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[methyl(methylaminomethyl)amino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115226717 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-[methyl(methylaminomethyl)amino]-4H-1,4-benzothiazin-3-one |
| SMILES | CNCN(C)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H15N3OS/c1-12-7-14(2)8-3-4-10-9(5-8)13-11(15)6-16-10/h3-5,12H,6-7H2,1-2H3,(H,13,15) |
| InChIKey | ZHPOAMUPBSQOOP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|