C18H19N3O2S — CID 110771553
N-[4-(dimethylamino)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide (PubChem CID 110771553) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 110771553 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
| SMILES | CN(C)c1ccc(NC(=O)Cc2ccc3c(c2)NC(=O)CS3)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-21(2)14-6-4-13(5-7-14)19-17(22)10-12-3-8-16-15(9-12)20-18(23)11-24-16/h3-9H,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | FKCOTOQRTMDHEW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|