C11H12N2O3S — CID 115138762
3-hydroxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide (PubChem CID 115138762) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-hydroxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide.
| Compound Name | 3-hydroxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
|---|---|
| PubChem CID | 115138762 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-hydroxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
| SMILES | O=C(CCO)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H12N2O3S/c14-4-3-10(15)12-7-1-2-9-8(5-7)13-11(16)6-17-9/h1-2,5,14H,3-4,6H2,(H,12,15)(H,13,16) |
| InChIKey | BAOQQNHFNBWODH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |