C11H11ClN2O2S — CID 43699746
3-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide (PubChem CID 43699746) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 3-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide.
| Compound Name | 3-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
|---|---|
| PubChem CID | 43699746 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
| SMILES | O=C(CCCl)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H11ClN2O2S/c12-4-3-10(15)13-7-1-2-9-8(5-7)14-11(16)6-17-9/h1-2,5H,3-4,6H2,(H,13,15)(H,14,16) |
| InChIKey | JQSCHDGDPYUTDG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|