C17H22N2O2S — CID 31720740
3-cyclohexyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide (PubChem CID 31720740) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 3-cyclohexyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide.
| Compound Name | 3-cyclohexyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
|---|---|
| PubChem CID | 31720740 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-cyclohexyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C17H22N2O2S/c20-16(9-6-12-4-2-1-3-5-12)18-13-7-8-15-14(10-13)19-17(21)11-22-15/h7-8,10,12H,1-6,9,11H2,(H,18,20)(H,19,21) |
| InChIKey | ITQOXOIIKSMYEM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |