C17H16N2O2S — CID 37015148
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenylpropanamide (PubChem CID 37015148) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenylpropanamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 37015148 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C17H16N2O2S/c20-16(9-6-12-4-2-1-3-5-12)18-13-7-8-15-14(10-13)19-17(21)11-22-15/h1-5,7-8,10H,6,9,11H2,(H,18,20)(H,19,21) |
| InChIKey | CIMLDSYMFQRBDQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |