C16H13N3O4S — CID 35874973
2-(2-nitrophenyl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide (PubChem CID 35874973) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 35874973 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(2-nitrophenyl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C16H13N3O4S/c20-15(7-10-3-1-2-4-13(10)19(22)23)17-11-5-6-14-12(8-11)18-16(21)9-24-14/h1-6,8H,7,9H2,(H,17,20)(H,18,21) |
| InChIKey | QQWQNHAZVFUORC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|