C15H14N2O2S2 — CID 37015324
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-thiophen-3-ylpropanamide (PubChem CID 37015324) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-thiophen-3-ylpropanamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 37015324 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C15H14N2O2S2/c18-14(4-1-10-5-6-20-8-10)16-11-2-3-13-12(7-11)17-15(19)9-21-13/h2-3,5-8H,1,4,9H2,(H,16,18)(H,17,19) |
| InChIKey | AWNRUQWVOAPCNV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |