C19H20N2O3S — CID 39641384
3-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide (PubChem CID 39641384) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide.
| Compound Name | 3-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
|---|---|
| PubChem CID | 39641384 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
| SMILES | Cc1ccc(OCCC(=O)Nc2ccc3c(c2)NC(=O)CS3)c(C)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-12-3-5-16(13(2)9-12)24-8-7-18(22)20-14-4-6-17-15(10-14)21-19(23)11-25-17/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | PMZCKASEYPCCAT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |