C18H18N2O3S — CID 35875238
2-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide (PubChem CID 35875238) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 35875238 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc3c(c2)NC(=O)CS3)c(C)c1 |
| InChI | InChI=1S/C18H18N2O3S/c1-11-3-5-15(12(2)7-11)23-9-17(21)19-13-4-6-16-14(8-13)20-18(22)10-24-16/h3-8H,9-10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | WNRQMYZLZQTOMS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |