C11H13N3O2S — CID 115168419
1-methyl-1-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea (PubChem CID 115168419) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-methyl-1-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea.
| Compound Name | 1-methyl-1-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea |
|---|---|
| PubChem CID | 115168419 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-methyl-1-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea |
| SMILES | CN(Cc1ccc2c(c1)NC(=O)CS2)C(N)=O |
| InChI | InChI=1S/C11H13N3O2S/c1-14(11(12)16)5-7-2-3-9-8(4-7)13-10(15)6-17-9/h2-4H,5-6H2,1H3,(H2,12,16)(H,13,15) |
| InChIKey | ARTNVPGYNXJNRG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |