C12H14N2O2S — CID 110784725
N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide (PubChem CID 110784725) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide.
| Compound Name | N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110784725 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide |
| SMILES | CCC(=O)NCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H14N2O2S/c1-2-11(15)13-6-8-3-4-10-9(5-8)14-12(16)7-17-10/h3-5H,2,6-7H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | MFNWNVCHYAZALS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |