C19H20N2O2S — CID 110790833
2-(2-methylphenyl)-N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]acetamide (PubChem CID 110790833) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-(2-methylphenyl)-N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]acetamide.
| Compound Name | 2-(2-methylphenyl)-N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110790833 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(2-methylphenyl)-N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]acetamide |
| SMILES | Cc1ccccc1CC(=O)NCCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C19H20N2O2S/c1-13-4-2-3-5-15(13)11-18(22)20-9-8-14-6-7-17-16(10-14)21-19(23)12-24-17/h2-7,10H,8-9,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | SICZMCZMFQAYCA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |