C11H14N2O3S2 — CID 110790838
N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]methanesulfonamide (PubChem CID 110790838) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 110790838 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | N-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H14N2O3S2/c1-18(15,16)12-5-4-8-2-3-10-9(6-8)13-11(14)7-17-10/h2-3,6,12H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | BERDDBXHORVMHS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |