C11H14N2OS2 — CID 115228287
6-[2-(sulfanylmethylamino)ethyl]-4H-1,4-benzothiazin-3-one (PubChem CID 115228287) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 6-[2-(sulfanylmethylamino)ethyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[2-(sulfanylmethylamino)ethyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115228287 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 6-[2-(sulfanylmethylamino)ethyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(CCNCS)cc2N1 |
| InChI | InChI=1S/C11H14N2OS2/c14-11-6-16-10-2-1-8(3-4-12-7-15)5-9(10)13-11/h1-2,5,12,15H,3-4,6-7H2,(H,13,14) |
| InChIKey | LFUXRAAVDHAVDR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|