C13H15N3OS — CID 115231132
3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethylamino]propanenitrile (PubChem CID 115231132) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethylamino]propanenitrile.
| Compound Name | 3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethylamino]propanenitrile |
|---|---|
| PubChem CID | 115231132 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethylamino]propanenitrile |
| SMILES | N#CCCNCCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C13H15N3OS/c14-5-1-6-15-7-4-10-2-3-12-11(8-10)16-13(17)9-18-12/h2-3,8,15H,1,4,6-7,9H2,(H,16,17) |
| InChIKey | CTAAOQWPUCDOBN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|