C12H13N3OS — CID 117043536
methyl-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]cyanamide (PubChem CID 117043536) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is methyl-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]cyanamide.
| Compound Name | methyl-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]cyanamide |
|---|---|
| PubChem CID | 117043536 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]cyanamide |
| SMILES | CN(C#N)CCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H13N3OS/c1-15(8-13)5-4-9-2-3-11-10(6-9)14-12(16)7-17-11/h2-3,6H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | WQHVLDKCWNCDKE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|