C10H8F3NOS — CID 116932177
6-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 116932177) has the molecular formula C10H8F3NOS and a molecular weight of 247.24 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116932177 |
| Molecular Formula | C10H8F3NOS |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 6-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(CC(F)(F)F)cc2N1 |
| InChI | InChI=1S/C10H8F3NOS/c11-10(12,13)4-6-1-2-8-7(3-6)14-9(15)5-16-8/h1-3H,4-5H2,(H,14,15) |
| InChIKey | IVZLQVVKDGTDAS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |