C8H6INOS — CID 90281504
6-iodo-4H-1,4-benzothiazin-3-one (PubChem CID 90281504) has the molecular formula C8H6INOS and a molecular weight of 291.11 g/mol. Its IUPAC name is 6-iodo-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-iodo-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90281504 |
| Molecular Formula | C8H6INOS |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 290.92 |
| IUPAC Name | 6-iodo-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(I)cc2N1 |
| InChI | InChI=1S/C8H6INOS/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4H2,(H,10,11) |
| InChIKey | BPXVFAPSAJRFHT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|