C10H10N2O2S — CID 82494432
6-(2-aminoacetyl)-4H-1,4-benzothiazin-3-one (PubChem CID 82494432) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 6-(2-aminoacetyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(2-aminoacetyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 82494432 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 6-(2-aminoacetyl)-4H-1,4-benzothiazin-3-one |
| SMILES | NCC(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C10H10N2O2S/c11-4-8(13)6-1-2-9-7(3-6)12-10(14)5-15-9/h1-3H,4-5,11H2,(H,12,14) |
| InChIKey | ZDMILNOMXNVCSC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |