C17H15NO3S — CID 16577438
(2-methylphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 16577438) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (2-methylphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | (2-methylphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 16577438 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (2-methylphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | Cc1ccccc1COC(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C17H15NO3S/c1-11-4-2-3-5-13(11)9-21-17(20)12-6-7-15-14(8-12)18-16(19)10-22-15/h2-8H,9-10H2,1H3,(H,18,19) |
| InChIKey | LQRFGFLIPIGZRL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |