C14H11NO4S — CID 47348563
furan-3-ylmethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 47348563) has the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. Its IUPAC name is furan-3-ylmethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | furan-3-ylmethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 47348563 |
| Molecular Formula | C14H11NO4S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | furan-3-ylmethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | O=C1CSc2ccc(C(=O)OCc3ccoc3)cc2N1 |
| InChI | InChI=1S/C14H11NO4S/c16-13-8-20-12-2-1-10(5-11(12)15-13)14(17)19-7-9-3-4-18-6-9/h1-6H,7-8H2,(H,15,16) |
| InChIKey | HRJDOOMRPPPJED-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |