C11H12N2O3S — CID 17412810
N-ethoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 17412810) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is N-ethoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-ethoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 17412810 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N-ethoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCONC(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H12N2O3S/c1-2-16-13-11(15)7-3-4-9-8(5-7)12-10(14)6-17-9/h3-5H,2,6H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | KPPRMKILEHMRLE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|