C16H20N2O2S — CID 2712276
N-(cyclohexylmethyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 2712276) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 2712276 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(cyclohexylmethyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1CSc2ccc(C(=O)NCC3CCCCC3)cc2N1 |
| InChI | InChI=1S/C16H20N2O2S/c19-15-10-21-14-7-6-12(8-13(14)18-15)16(20)17-9-11-4-2-1-3-5-11/h6-8,11H,1-5,9-10H2,(H,17,20)(H,18,19) |
| InChIKey | AZVKUPNREXXVEG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |