C18H25N3O2S — CID 119619160
N-[2-(cycloheptylamino)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 119619160) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 119619160 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1CSc2ccc(C(=O)NCCNC3CCCCCC3)cc2N1 |
| InChI | InChI=1S/C18H25N3O2S/c22-17-12-24-16-8-7-13(11-15(16)21-17)18(23)20-10-9-19-14-5-3-1-2-4-6-14/h7-8,11,14,19H,1-6,9-10,12H2,(H,20,23)(H,21,22) |
| InChIKey | KQRGQNKEZYNIBN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|