C19H27N3O2 — CID 119619891
N-[2-(cycloheptylamino)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 119619891) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 119619891 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | O=C1CCc2cc(C(=O)NCCNC3CCCCCC3)ccc2N1 |
| InChI | InChI=1S/C19H27N3O2/c23-18-10-8-14-13-15(7-9-17(14)22-18)19(24)21-12-11-20-16-5-3-1-2-4-6-16/h7,9,13,16,20H,1-6,8,10-12H2,(H,21,24)(H,22,23) |
| InChIKey | BQWACOFMOMFUPF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|