C14H19N3O2 — CID 103806261
N-(3-aminobutyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 103806261) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-(3-aminobutyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 103806261 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(3-aminobutyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | CC(N)CCNC(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O2/c1-9(15)6-7-16-14(19)11-2-4-12-10(8-11)3-5-13(18)17-12/h2,4,8-9H,3,5-7,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | LKAHCDADJFCWSH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |