C20H30N4O2 — CID 119620864
N-[2-(cycloheptylamino)ethyl]-1-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide (PubChem CID 119620864) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide |
|---|---|
| PubChem CID | 119620864 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepine-7-carboxamide |
| SMILES | CN1CCC(=O)Nc2cc(C(=O)NCCNC3CCCCCC3)ccc21 |
| InChI | InChI=1S/C20H30N4O2/c1-24-13-10-19(25)23-17-14-15(8-9-18(17)24)20(26)22-12-11-21-16-6-4-2-3-5-7-16/h8-9,14,16,21H,2-7,10-13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | HUSQOJAEBHHGRX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|