C15H18N2O3 — CID 18108766
2-oxo-N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 18108766) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-oxo-N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | 2-oxo-N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 18108766 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-oxo-N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | O=C1CCc2cc(C(=O)NCC3CCCO3)ccc2N1 |
| InChI | InChI=1S/C15H18N2O3/c18-14-6-4-10-8-11(3-5-13(10)17-14)15(19)16-9-12-2-1-7-20-12/h3,5,8,12H,1-2,4,6-7,9H2,(H,16,19)(H,17,18) |
| InChIKey | XHPDBUWEZCHTDT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |