C24H28N2O2 — CID 58923659
N-[(4-benzylcyclohexyl)methyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 58923659) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[(4-benzylcyclohexyl)methyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-[(4-benzylcyclohexyl)methyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 58923659 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[(4-benzylcyclohexyl)methyl]-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | O=C1CCc2cc(C(=O)NCC3CCC(Cc4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C24H28N2O2/c27-23-13-11-20-15-21(10-12-22(20)26-23)24(28)25-16-19-8-6-18(7-9-19)14-17-4-2-1-3-5-17/h1-5,10,12,15,18-19H,6-9,11,13-14,16H2,(H,25,28)(H,26,27) |
| InChIKey | XURBUAROANQYMA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |