C24H22N2O2 — CID 46564543
N-(1,2-diphenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 46564543) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-(1,2-diphenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 46564543 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(1,2-diphenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | O=C1CCc2cc(C(=O)NC(Cc3ccccc3)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C24H22N2O2/c27-23-14-12-19-16-20(11-13-21(19)25-23)24(28)26-22(18-9-5-2-6-10-18)15-17-7-3-1-4-8-17/h1-11,13,16,22H,12,14-15H2,(H,25,27)(H,26,28) |
| InChIKey | ZZQUCWWGHCDXKL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |