C22H18N2O2 — CID 108784603
N-benzhydryl-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 108784603) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-benzhydryl-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-benzhydryl-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 108784603 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-benzhydryl-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NC(c3ccccc3)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C22H18N2O2/c25-20-14-18-13-17(11-12-19(18)23-20)22(26)24-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,23,25)(H,24,26) |
| InChIKey | OSHUEDCDXQJKKQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |